Версия для слабовидящих

 —  — index




value
standardversionhttp://opendata.gosmonitor.ru/standard/3.0
identifier4205077241-terrorgani
titleПеречень подведомственных организаций
descriptionПеречень подведомственных организаций (государственные областные учреждения культуры и искусства Кемеровской области)
creatorДепартамент культуры и национальной политики Кемеровской области
created11.09.2013
modified09.08.2016
subjectПеречень подведомственных организаций
formatCSV
provenance
validПо мере внесения изменений
publishernameВоробьев Сергей Олегович
publisherphone8(3842)583082
publishermboxdep-kult@ako.ru
data-20160830-structure-20160830http://depcult.ru/opendata/4205077241-terrorgani/data-20160830.csv
structure-20160830http://depcult.ru/opendata/4205077241-terrorgani/structure-20160830.csv